Tedizolid Phosphate
Tedizolid Phosphate is the phosphate salt form of tedizolid, an antibacterial agent of the oxazolidinone class, that is used for the treatment of acute bacterial skin and skin structure infections caused by certain Gram-positive microorganisms.
| Catalog Number | API856867555 |
| Alternative Name(s) | Torezolid phosphate;Sivextro;TR-701FA |
| Research Area | Antibacterial APIs |
| Molecular Formula | C17H16FN6O6P |
| CAS# | 856867-55-5 |
| SMILES | CN1N=C(N=N1)C2=NC=C(C=C2)C3=C(C=C(C=C3)N4CC(OC4=O)COP(=O)(O)O)F |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/tedizolid-phosphate-item-12161.html |