Tedizolid Phosphate
Tedizolid Phosphate is an oxazolidinone-class antibiotic prodrug used to treat acute bacterial skin and skin structure infections (ABSSSI) caused by susceptible isolates of several Gram-positive bacteria.
| Trivial name | TR-701FA |
| Catalog Number | CSN16040 |
| Alternative Name(s) | TR-701FA |
| Research Area | Infection |
| Molecular Formula | C17H16FN6O6P |
| CAS# | 856867-55-5 |
| Purity | ≥99% |
| SMILES | O=C1O[C@@H](COP(O)(O)=O)CN1C2=CC=C(C3=CC=C(C4=NN(C)N=N4)N=C3)C(F)=C2 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/tedizolid-phosphate.html |
