Asenapine maleate 10mM * 1mL in DMSO
Asenapine shows high affinity (pKi) for numerous receptors, including the serotonin 5-HT1A (8.6), 5-HT1B (8.4), 5-HT2A (10.2), 5-HT2B (9.8), 5-HT2C (10.5), 5-HT5A (8.8), 5-HT6 (9.5), and 5-HT7 (9.9) receptors, the adrenergic ??1 (8.9), ??2A (8.9), ??2B (9.5), and ??2C (8.9) receptors, the dopamine D1 (8.9), D2 (8.9), D3 (9.4), and D4 (9.0) receptors, and the histamine H1 (9.0) and H2 (8.2) receptors.
| Trivial name | Asenapine maleate 10mM * 1mL in DMSO |
| Catalog Number | A10091-10mM-D |
| Alternative Name(s) | trans-5-Chloro-2,3,3a,12b-tetrahydro-2-methyl-1H-dibenz[2,3:6,7]oxepino[4,5-c]pyrrole maleate |
| Molecular Formula | C17H16ClNO.C4H4O4 |
| CAS# | 85650-56-2 |
| SMILES | CN1C[C@H]2[C@H](C1)C3=C(C=CC(=C3)Cl)OC4=CC=CC=C24.C(=CC(=O)O)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/asenapine-maleate.html |