Piperaquine Phosphate
API Standard
| Catalog Number | CS-O-02169 |
| Alternative Name(s) | 7-chloro-4-(4-{3-[4-(7-chloroquinolin-4-yl)piperazin-1-yl]propyl}piperazin-1-yl)quinoline; phosphoric acid |
| Research Area | Piperaquine Phosphate is an antimalarial drug, a bisquinoline first synthesised in the 1960s, and used extensively in China and Indochina as prophylaxis and treatment during the next 20 years. |
| CAS# | 85547-56-4 |
| Purity | >98% |
| SMILES | ClC1=CC=C2C(N=CC=C2N3CCN(CCCN4CCN(C5=CC=NC6=CC(Cl)=CC=C56)CC4)CC3)=C1.O=[P](O)(O)O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02169.html |