Itraconazole EP Impurity B
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-62239 |
| Alternative Name(s) | Itraconazole EP Impurity B;(1,2,4-Triazol-4-yl) Itraconazole.;1-(butan-2-yl)-4-{4-[4-(4-{[(2S,4R)-2-(2,4- dichlorophenyl)-2-(1H-1,2,4-triazol-1-ylmethyl)- 1,3-dioxolan-4-yl]methoxy}phenyl)piperazin-1- yl]phenyl}-4,5-dihydro-1H-1,2,4-triazol-5-one;(1,2,4-Triazol-4-yl) Itraconazole. |
| Research Area | An isomer and impurity in commercial preparation of Itraconazole. |
| Molecular Formula | NULL |
| CAS# | 854372-77-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=C(C=CC(Cl)=C1)[C@@]2(O[C@@H](COC3=CC=C(N4CCN(C5=CC=C(N(C=NN6C(C)CC)C6=O)C=C5)CC4)C=C3)CO2)CN7C=NN=C7 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST62239.html |
| Additional Information | NULL |