SKF-89976A HCl
SKF-89976A HCl is a selective GABA transporter (GAT-1) inhibitor with IC50s of 0.28 μM, 137.34 μM and 202.8 μM for GAT-1, GAT-2 and GAT-3 in CHO cells, respectively.
| Trivial name | / |
| Catalog Number | CSN17061 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C22H26ClNO2 |
| CAS# | 85375-15-1 |
| Purity | ≥98% |
| SMILES | O=C(C1CN(CC/C=C(C2=CC=CC=C2)/C3=CC=CC=C3)CCC1)O.[H]Cl |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/skf-89976a-hcl.html |