MC1568 25mg
MC1568 is a member of HDAC inhibitors that inhibits the histone deacetylase class II by modifying the genetic expression of various important genes of cell cycle mostly at G1 phase, resulting in the death of breast cancer cells by apoptosis.
| Trivial name | MC1568 25mg |
| Catalog Number | A10560-25 |
| Alternative Name(s) | 3-[5-(3-(3-Fluorophenyl)-3-oxopropen-1-yl)-1-methyl-1H-pyrrol-2-yl]-N-hydroxy-2-propenamide |
| Molecular Formula | C17H15FN2O3 |
| CAS# | 852475-26-4 |
| SMILES | CN1C=C(C=C1/C=C/C(=O)NO)/C=C/C(=O)C2=CC(=CC=C2)F |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/mc1568.html |
