OC000459
Antagonist of D prostanoid receptor 2 ,potent and selective GPCR/G protein|GPR44
| Catalog Number | B1535-5 |
| Research Area | GPCR/G protein|GPR44 |
| Molecular Formula | C21H17FN2O2 |
| CAS# | 851723-84-7, 950688-14-9 (sodium salt) |
| Purity | 98% |
| SMILES | CC1=C(C2=C(N1CC(=O)O)C=CC(=C2)F)CC3=NC4=CC=CC=C4C=C3 |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1535 |
