Danoprevir
Danoprevir is a peptidomimetic inhibitor of the NS3/4A protease of hepatitis C virus (HCV) with IC50 of 0.2-3.5 nM, inhibition effect for HCV genotypes 1A/1B/4/5/6 is ~10-fold higher than 2B/3A. Phase 2.
| Trivial name | ITMN-191, RG7227 |
| Catalog Number | S1183 |
| Molecular Formula | C13H19NO2 |
| CAS# | 850876-88-9 |
| Inchi | InChI=1S/C13H19NO2/c1-4-13(2,3)12(15)14(16)10-11-8-6-5-7-9-11/h5-9,16H,4,10H2,1-3H3 |
| Inchi Key | AVYVHIKSFXVDBG-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C(=O)N(CC1=CC=CC=C1)O |
| Size | 2mg |
| Supplier Page | http://www.selleckchem.com/products/Danoprevir.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Danoprevir-chemical-structure-s1183.jpg |
