LyP-2 | MedChemExpress (MCE)
LyP-2 is a peptide that homes to tumor lymphatics. LyP2 homes to lymphatics of C8161 melanomas and cervical carcinomas and K14-HPV16 skin, but not to MDA-MB435 tumors, showing heterogeneity in the molecular markers of tumor cells and lymphatics[1].
| Trivial name | LyP-2 |
| Catalog Number | HY-P4088 |
| Research Area | Cancer |
| CAS# | 850859-24-4 |
| Purity | ≥98.00% |
| SMILES | O=C(N[C@@H](CC(N)=O)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CCCNC(N)=N)C(N[C@@H]([C@H](O)C)C(N[C@@H](CCCCN)C(N[C@@H](C)C(NCC(N[C@@H](CS)C(O)=O)=O)=O)=O)=O)=O)=O)=O)[C@H](CS)N |
| PubChem Chemical Structure ID | 166642675 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lyp-2.html |