ADL5859 HCl 10mM * 1mL in DMSO
ADL5859 HCl is a highly potent and selective ?? opioid receptor agonist with Ki value to be 0.84 nM and ED50 value to be 20 nM.
| Trivial name | ADL5859 HCl 10mM * 1mL in DMSO |
| Catalog Number | A11072-10mM-D |
| Alternative Name(s) | N,N-Diethyl-4-(5-hydroxyspiro[2H-1-benzopyran-2,4'-piperidin]-4-yl)benzamide hydrochloride |
| Molecular Formula | C24H28N2O3.HCl |
| CAS# | 850173-95-4 |
| SMILES | CCN(CC)C(=O)C1=CC=C(C=C1)C2=CC3(CCNCC3)OC4=C2C(=CC=C4)O.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/adl5859-hcl.html |
