Afatinib Dimaleate
A quinazoline and butenamide derivative that acts as a tyrosine kinase inhibitor of epidermal growth factor receptors (ERBB RECEPTORS) and is used in the treatment of metastatic NON-SMALL CELL LUNG CANCER.
| Catalog Number | API850140737 |
| Alternative Name(s) | Afatinib (diMaleate);Gilotrif;Giotrif |
| Research Area | Anti-Tumor APIs |
| Molecular Formula | C32H33ClFN5O11 |
| CAS# | 850140-73-7 |
| SMILES | CN(C)CC=CC(=O)NC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)F)Cl)OC4CCOC4.C(=CC(=O)O)C(=O)O.C(=CC(=O)O)C(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/afatinib-dimaleate-item-12540.html |