1-(2-Pyridylazo)-2-naphthol | MedChemExpress (MCE)
1-(2-Pyridylazo)-2-naphthol (1-Pyridylazo-2-naphthol) is an azo compound. 1-(2-Pyridylazo)-2-naphthol can be used as a chelating precipitant, flocculant, auxiliary complexing agent, and as a ligand for anchoring on other supports with the purpose of introducing
chelating property[1].
| Trivial name | 1-(2-Pyridylazo)-2-naphthol |
| Catalog Number | HY-D0223 |
| Alternative Name(s) | 1-Pyridylazo-2-naphthol |
| Research Area | Others |
| CAS# | 85-85-8 |
| Purity | ≥98.0% |
| SMILES | OC1=C(/N=N/C2=NC=CC=C2)C3=C(C=CC=C3)C=C1 |
| Size | 25 g |
| Supplier Page | https://www.medchemexpress.com/1-2-pyridylazo-2-naphthol.html |