3-Nitrosalicylic Acid
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-37158 |
| Alternative Name(s) | Mesalazine Impurity R;3-NITROSALICYLIC ACID;2-Hydroxy-3-nitrobenzoic Acid ;2-Hydroxy-3-nitrobenzoic Acid;2-hydroxy-3-nitrobenzoic acid |
| Research Area | A nitrohumic acid which has been shown to bind to Molybdenum to impart fertility to soil and water and is a key element in the activity of nitrogenase. |
| Molecular Formula | NULL |
| CAS# | 85-38-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(C=CC=C1[N](=O)=O)=C1O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST37158.html |
| Additional Information | NULL |
