Cevipabulin (TTI-237) 5mg
Cevipabulin (TTI-237), an antimicrotubule agent, is a small synthetic molecule of triazolopyrimidine derivative with potential antitumor activity. With a novel mechanism of action distinct from the action of other vinca alkaloid compounds, TTI-237 specifically binds to tubulin at the vinca site, and promotes the polymerization of tubulin into microtubules.
Trivial name | Cevipabulin (TTI-237) 5mg |
Catalog Number | A12591-5 |
Alternative Name(s) | 5-Chloro-6-[2,6-difluoro-4-[3-(methylamino)propoxy]phenyl]-N-((1S)-2,2,2-trifluoro-1-methylethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
Molecular Formula | C18H18ClF5N6O |
CAS# | 849550-05-6 |
SMILES | C[C@@H](C(F)(F)F)NC1=C(C(=NC2=NC=NN12)Cl)C3=C(C=C(C=C3F)OCCCNC)F |
Size | 5mg |
Supplier Page | http://www.adooq.com/cevipabulin-tti-237.html |