XL184 free base 10mM * 1mL in DMSO
XL184 free base (Cabozantinib) is a small molecule designed to inhibit multiple receptor tyrosine kinases, specifically MET and VEGFR2.
Trivial name | XL184 free base 10mM * 1mL in DMSO |
Catalog Number | A10996-10mM-D |
Alternative Name(s) | N-(4-((6,7-Dimethoxyquinolin-4-yl)oxy)phenyl)-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
Molecular Formula | C28H24FN3O5 |
CAS# | 849217-68-1 |
SMILES | COC1=CC2=C(C=CN=C2C=C1OC)OC3=CC=C(C=C3)NC(=O)C4(CC4)C(=O)NC5=CC=C(C=C5)F |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/xl184-free-base-cabozantinib.html |