BIIB021
BIIB021 (CNF2024) is an orally available, fully synthetic small-molecule inhibitor of HSP90 with Ki and EC50 of 1.7 nM and 38 nM, respectively. Phase 2.
| Trivial name | CNF2024 |
| Catalog Number | S1175 |
| Molecular Formula | C12H12O2 |
| CAS# | 848695-25-0 |
| Inchi | InChI=1S/C12H12O2/c1-2-3-8-11-9-6-4-5-7-10(9)12(13)14-11/h4-8H,2-3H2,1H3/b11-8- |
| Inchi Key | WMBOCUXXNSOQHM-FLIBITNWSA-N |
| SMILES | CCCC=C1C2=CC=CC=C2C(=O)O1 |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/BIIB021.html |
| Additional Information | https://file.selleck.cn/downloads/struct/BIIB021-chemical-structure-S1175.gif |
