BIIB021 10mM * 1mL in DMSO
BIIB021 is an oral fully synthetic Hsp90 inhibitor that selectively and potently inhibits the molecular chaperone Hsp90 thereby inhibiting the proper assembly of multiple oncogenic proteins involved in tumor growth and survival.
| Trivial name | BIIB021 10mM * 1mL in DMSO |
| Catalog Number | A10143-10mM-D |
| Alternative Name(s) | 6-Chloro-9-[(4-methoxy-3,5-dimethyl-2-pyridinyl)methyl]-9H-purin-2-amine |
| Molecular Formula | C14H15ClN6O |
| CAS# | 848695-25-0 |
| SMILES | CC1=CN=C(C(=C1OC)C)CN2C=NC3=C2N=C(N=C3Cl)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/biib021.html |
