A-582941 25mg
A-582941 is a selective AChR a7 partial agonist. It exhibits high affinity for both rat and human a7 receptors (Ki values are 10.8 and 16.7 nM, respectively).
| Trivial name | A-582941 25mg |
| Catalog Number | A13539-25 |
| Alternative Name(s) | Pyrrolo(3,4-C)pyrrole, octahydro-2-methyl-5-(6-phenyl-3-pyridazinyl)-, dihydrochloride |
| Molecular Formula | C17H20N4 |
| CAS# | 848591-90-2 |
| SMILES | CN1C[C@@H]2CN(C[C@@H]2C1)C3=NN=C(C=C3)C4=CC=CC=C4 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/a-582941.html |
