Rac-Pemafibrate | MedChemExpress (MCE)
Pemafibrate racemate (K13675 racemate) is the racemate of pemafibrate, and activates PPARα activity, with EC50s of 1 nM, >10 μM and 1.7 μM for h-PPARα, h-PPARγ and h-PPARδ, respectively.
| Trivial name | Rac-Pemafibrate |
| Catalog Number | HY-17618A |
| Alternative Name(s) | Rac-K13675 |
| Research Area | Inflammation/Immunology |
| CAS# | 848258-31-1 |
| Purity | ≥98.0% |
| SMILES | CCC(OC1=CC=CC(CN(C2=NC3=CC=CC=C3O2)CCCOC4=CC=C(OC)C=C4)=C1)C(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/Pemafibrate-racemate.html |