Enalaprilat dihydrate 10mM * 1mL in DMSO
Enalaprilat is the active metabolite of enalapril. It is the first dicarboxylate-containing ACE inhibitor and was developed partly to overcome these limitations of captopril.
| Trivial name | Enalaprilat dihydrate 10mM * 1mL in DMSO |
| Catalog Number | A10351-10mM-D |
| Alternative Name(s) | (2S)-1-[(2S)-2-[[(1S)-1-Carboxy-3-phenyl-propyl]amino]propanoyl]pyrrolidine-2-carboxylic acid |
| Molecular Formula | N/A |
| CAS# | 84680-54-6 |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)N[C@@H](CCC2=CC=CC=C2)C(=O)O.O.O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/enalaprilat-dihydrate.html |