α-Conotoxin BuIA | MedChemExpress (MCE)
α-Conotoxin BuIA is a paralytic peptide neurotoxin and a competitive nAChR antagonist, with IC50s of 0.258 nM (α6/α3β2), 1.54 nM (α6/α3β4), 5.72 nM (α3β2), respectively. α-Conotoxin BuIA can be used to distinguish nAChRs containing β2- and β4-subunit, respectively. α-Conotoxin BuIA distinguishes among αxβ2 nAChRs with a rank order potency of α6>α3>α2>α4[1].
| Trivial name | α-Conotoxin BuIA |
| Catalog Number | HY-P5148 |
| Research Area | Neurological Disease |
| CAS# | 846539-62-6 |
| Purity | ≥98.00% |
| SMILES | O=C(CN)N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N1[C@H](C(N2[C@H]3CCC2)=O)CCC1)=O)[C@@H](C)O)=O)CO)=O)CSSC[C@H](NC4=O)C(N)=O)=O)CSSC[C@H](NC3=O)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H]4CC5=CC=C(O)C=C5)=O)CC(C)C)=O)C(C)C)=O)C)=O |
| PubChem Chemical Structure ID | 76324743 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-conotoxin-buia.html |