Cycloastragenol
Intermediates
| Trivial name | NULL |
| Catalog Number | CS-T-51409 |
| Alternative Name(s) | Cyclogalegigenin;(3,6a,16,24R)-20,24-EpoxyCyclogalegenin; Cyclogalegigenin;78574-94-4. |
| Research Area | Cycloastragenol is an aglycone derivative of astragaloside IV found in the root of Korean Astragalus membranaceus. |
| Molecular Formula | NULL |
| CAS# | 84605-18-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@]([C@@]1(CC2)C)(C[C@H](O)[C@]1([H])[C@]3(O[C@@H](C(C)(O)C)CC3)C)[C@@](C[C@H](O)[C@@]4([H])C5(C)C)([H])[C@@]62[C@]4(CC[C@@H]5O)C6 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST51409.html |
| Additional Information | NULL |