Rocaglamide
Rocaglamide, a naturally occurring product isolated from the herbs of Aglaia odorata Lour, induces apoptosis through the intrinsic death pathway in various human leukemia cell lines and in acute lymphoblastic leukemia, chronic myeloid leukemia and acute myeloid leukemia cells freshly isolated from patients.
| Trivial name | Rocaglamide A; Roc-A |
| Catalog Number | CSN12999 |
| Alternative Name(s) | Rocaglamide A; Roc-A |
| Research Area | Cancer |
| Molecular Formula | C29H31NO7 |
| CAS# | 84573-16-0 |
| Purity | ≥99% |
| SMILES | O=C([C@H]([C@H]1C2=CC=CC=C2)[C@@H](O)[C@]3(O)[C@@]1(C4=CC=C(OC)C=C4)OC5=CC(OC)=CC(OC)=C35)N(C)C |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/rocaglamide.html |