AT7519
AT7519 is a multi-CDK inhibitor for CDK1, 2, 4, 6 and 9 with IC50 of 10-210 nM. It is less potent to CDK3 and little active to CDK7. AT7519 also decrease GSK3β phosphorylation. AT7519 induces apoptosis. Phase 2.
| Trivial name | AT7519M |
| Catalog Number | S1524 |
| Molecular Formula | C27H34N4.2I |
| CAS# | 844442-38-2 |
| SMILES | CC[N+](C)(CC)CCC[N+]1=C2C=C(C=CC2=C3C=CC(=CC3=C1C4=CC=CC=C4)N)N.[I-].[I-] |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/AT7519.html |
| Additional Information | https://file.selleck.cn/downloads/struct/AT7519-chemical-structure-S1524.gif |