TPO-L | MedChemExpress (MCE)
TPO-L is a photoinitiator that promotes two-photon induced polymerization. The two-photon absorption cross-section spectrum of Lucirin TPO-L shows a maximum of 1.2 GM at 610 nm. Despite its small two-photon absorption cross-section, Lucirin TPO-L exhibits high polymerization quantum yields[1].
| Trivial name | TPO-L |
| Catalog Number | HY-W017894 |
| Research Area | Others |
| CAS# | 84434-11-7 |
| Purity | ≥98.0% |
| SMILES | O=C(P(OCC)(C1=CC=CC=C1)=O)C2=C(C)C=C(C)C=C2C |
| Size | 25 g |
| Supplier Page | https://www.medchemexpress.com/tpo-l.html |