Bithionol Sulfoxide
Bithionol sulfoxide is a clinically approved anti-parasitic drug and has been shown to inhibit solid tumor growth in several preclinical cancer models.
| Trivial name | Bitin S |
| Catalog Number | CSN10470 |
| Alternative Name(s) | Bitin S |
| Research Area | Cancer |
| Molecular Formula | C12H6Cl4O3S |
| CAS# | 844-26-8 |
| Purity | ≥98% |
| SMILES | O=S(C1=CC(Cl)=CC(Cl)=C1O)C2=CC(Cl)=CC(Cl)=C2O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/bithionol-sulfoxide.html |