Raclopride
Raclopride is a dopamine D2/D3 receptor antagonist, which binds to D2 and D3 receptors with dissociation constants (Kis) of 1.8 nM and 3.5 nM, respectively, but has a very low affinity for D1 and D4 receptors with Kis of 18000 nM and 2400 nM, respectively .
| Trivial name | / |
| Catalog Number | CSN25233 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C15H20Cl2N2O3 |
| CAS# | 84225-95-6 |
| Purity | ≥99% |
| SMILES | O=C(NC[C@H]1N(CC)CCC1)C2=C(OC)C(Cl)=CC(Cl)=C2O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/raclopride.html |