R406 (free base)
R406 (free base) is a potent Syk inhibitor with IC50 of 41 nM in a cell-free assay, strongly inhibits Syk but not Lyn, 5-fold less potent to Flt3. R406 (free base) triggers apoptosis. Phase 1.
| Trivial name | N/A |
| Catalog Number | S1533 |
| Molecular Formula | C19H15ClN4O |
| CAS# | 841290-80-0 |
| SMILES | NC1=N[NH]C2=C1C=CC(=C2)C3=CN(CC4=CC(=CC=C4)Cl)C(=O)C=C3 |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/R406(free-base).html |
| Additional Information | https://file.selleck.cn/downloads/struct/R406-free-base-chemical-structure-S1533.gif |
