Roquinimex
Roquinimex is a quinoline derivative immunostimulant which increases NK cell activity and macrophage cytotoxicity and inhibits angiogenesis and reduces the secretion of TNF alpha.
| Trivial name | Linomide; FCF-89; LS-2616; ABR212616 |
| Catalog Number | CSN11309 |
| Alternative Name(s) | Linomide; FCF-89; LS-2616; ABR212616 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C18H16N2O3 |
| CAS# | 84088-42-6 |
| Purity | ≥98% |
| SMILES | O=C(C1=C(O)C2=C(N(C)C1=O)C=CC=C2)N(C)C3=CC=CC=C3 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/roquinimex.html |