Lamotrigine
Lamotrigine is a member of the sodium channel blocking class of antiepileptic drugs which can block L-, N-, and P-type calcium channels and has weak 5-HT3 receptor inhibition.
| Trivial name | BW-430C; LTG |
| Catalog Number | CSN12998 |
| Alternative Name(s) | BW-430C; LTG |
| Research Area | Neurological Disease |
| Molecular Formula | C9H7Cl2N5 |
| CAS# | 84057-84-1 |
| Purity | ≥99% |
| SMILES | NC1=NC(N)=C(C2=CC=CC(Cl)=C2Cl)N=N1 |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/lamotrigine.html |
