Azithromycin 13CD3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06431 |
| Alternative Name(s) | CP-62993-13Cd3; XZ-450-13Cd3; Azitrocin-13Cd3; Ribotrex-13Cd3; Sumamed- Cd3; Trozocina-d3; Zithromaz-13Cd3; Zitromax-13Cd3;Azitromax,5R,8R,10R,11R,12S,13S,14R)-11-(((2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)-2-ethyl-3,4,10-trihydroxy-13-(((2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyltetrahydro-2H-pyran-2-yl)oxy)-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-15-one 13CD3 |
| Research Area | Labeled Azithromycin, Intended for use as an internal standard for the quantification of Azithromycin by GC- or LC-mass spectrometry |
| Molecular Formula | NULL |
| CAS# | 83905-01-5 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H]([C@@H]([C@H](C(O[C@@H]([C@@](C)(O)[C@@H]1O)CC)=O)C)O[C@@](O[C@@H](C)[C@@H]2O)([H])C[C@@]2(C)OC)[C@H]([C@](O)(C[C@H](CN([C@@H]1C)[13C]([2H])([2H])[2H])C)C)O[C@@](O[C@H](C)C[C@@H]3N(C)C)([H])[C@@H]3O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06431.html |
| Additional Information | NULL |