Cetirizine Dihydrochloride
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01088 |
| Alternative Name(s) | Cetirizine Dihydrochloride;2-(2-{4-[azin-1-yl}ethoxchloride; Cetirizine dihydrochloride, [2-[4-[(4-Chlorophenyl)phenylmethyl]-1-piperazinyl]ethoxy]acetic acid dihydrochloride; CS-O-07597; 83881-51-0 |
| Research Area | A nonsedating type histamine H1-receptor antagonist. A major metabolite of Hydroxyzine. Pharmacological activity resides primarily in the (R)-isomer. Antihystaminic. |
| Molecular Formula | C21H27Cl3N2O3 |
| CAS# | 83881-52-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=CC=C(C=C1)C(C2=CC=CC=C2)N3CCN(CCOCC(O)=O)CC3.Cl.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01088.html |
| Additional Information | NULL |