Cetirizine 200mg
Cetirizine, a second-generation antihistamine, is a major metabolite of hydroxyzine, and a racemic selective H1 receptor inverse agonist used in the treatment of allergies, hay fever, angioedema, and urticaria.
| Trivial name | Cetirizine 200mg |
| Catalog Number | A15041-200 |
| Alternative Name(s) | 2-[2-[4-[(4-chlorophenyl)-phenylmethyl]piperazin-1-yl]ethoxy]acetic acid |
| Molecular Formula | C21H25ClN2O3 |
| CAS# | 83881-51-0 |
| SMILES | C1CN(CCN1CCOCC(=O)O)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/cetirizine.html |