WH 4-023 10mM * 1mL in DMSO
WH-4-023 is a potent and selective dual Lck/Src inhibitor with IC50 of 2 nM/6 nM for Lck and Src kinase respectively.
| Trivial name | WH 4-023 10mM * 1mL in DMSO |
| Catalog Number | A14117-10mM-D |
| Alternative Name(s) | 2,6-dimethylphenyl (2,4-dimethoxyphenyl)(2-((4-(4-methylpiperazin-1-yl)phenyl)amino)pyrimidin-4-yl)carbamate |
| Molecular Formula | C32H36N6O4 |
| CAS# | 837422-57-8 |
| SMILES | CC1=C(C(=CC=C1)C)OC(=O)N(C2=C(C=C(C=C2)OC)OC)C3=NC(=NC=C3)NC4=CC=C(C=C4)N5CCN(CC5)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/wh-4-023.html |