Lumirubin | MedChemExpress (MCE)
Lumirubin, a structural isomer of bilirubin, is the main photooxidative product formed during photoresearch for the research of neonatal jaundice, and has a certain pro-inflammatory effect[1].
| Trivial name | Lumirubin |
| Catalog Number | HY-126196 |
| Research Area | Metabolic Disease |
| CAS# | 83664-21-5 |
| Purity | ≥98.00% |
| SMILES | O=C(CCC1=C(N=C2C1(CC=C(C(NC3=O)=C2)C3C)C)CC4=C(C(C)=C(N4)/C=C(NC5=O)/C(C)=C5C=C)CCC(O)=O)O |
| PubChem Chemical Structure ID | 135570585 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lumirubin.html |