Dibenzosuberane
Dibenzosuberane is used as the base structure of various tricyclic antidepressants. Studies suggest that Dibenzosuberane and its analogues may have anti-viral properties.
| Catalog Number | CS-T-52444 |
| Alternative Name(s) | 1,2:4,5-Dibebenzo[a,11-Dihydrodibenzo[a,d]cycloheptene; 2,3:6,7-Dibenzosuberan; Dibenzo[a,d][1,4]cycloheptadiene; NSC 86156; Suberane; |
| Research Area | Intermediates |
| Molecular Formula | C15H14 |
| CAS# | 833-48-7 |
| Purity | >98% |
| SMILES | C12=CC=CC=C1CCC3=C(C=CC=C3)C2 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST52444.html |