Astragaloside A
Astragaloside A is one of the major active constituents of Astragalus membranaceus in traditional Chinese medicine and has been widely used to treat ischemic diseases.
| Trivial name | Astramembrannin I; Astramembrannin-IV; AS IV |
| Catalog Number | CSN16476 |
| Alternative Name(s) | Astramembrannin I; Astramembrannin-IV; AS IV |
| Research Area | Cancer |
| Molecular Formula | C41H68O14 |
| CAS# | 83207-58-3 |
| Purity | ≥98% |
| SMILES | O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](O[C@H]2C[C@]([C@@](C[C@H](O)[C@]3([H])[C@@]4(CC[C@H](C(C)(C)O)O4)C)(C)[C@]3(C)CC5)([H])[C@@]65[C@]7(C6)[C@]2([H])C(C)(C)[C@@H](O[C@@H]8OC[C@@H](O)[C@H](O)[C@H]8O)CC7)[C@@H]1O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/astragaloside-a.html |
