Phytic Acid
Phytic acid has a neuroprotective effect in MPTP-induced PD model, and the neuroprotection is correlated with its anti-inflammatory effect which may be associated with suppression of pathways that involved in NF-κB and p-ERK.
| Trivial name | Inositol Hexaphosphate |
| Catalog Number | CSN11712 |
| Alternative Name(s) | Inositol Hexaphosphate |
| Research Area | / |
| Molecular Formula | C6H18O24P6 |
| CAS# | 83-86-3 |
| Purity | 60% |
| SMILES | O=P(O)(O[C@H]1[C@H]([C@H]([C@@H]([C@H]([C@@H]1OP(O)(O)=O)OP(O)(O)=O)OP(O)(O)=O)OP(O)(O)=O)OP(O)(O)=O)O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/phytic-acid.html |
