Phytic acid solution
Phytic acid is a mineral chelator that can bind to minerals to form mineral-phytate complex.It can also complex with metal ions bound to the surface of magnesium alloy to form a conversion coating, which can improve the resistance of magnesium alloy towards corrosion.
| Catalog Number | CDC10-0112 |
| Alternative Name(s) | myo-Inositol hexakis(dihydrogen phosphate) |
| Research Area | Used for research and manufacturing |
| Molecular Formula | C6H18O24P6 |
| CAS# | 83-86-3 |
| Inchi | 1S/C6H18O24P6/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)/t1-,2-,3-,4+,5-,6- |
| SMILES | OP(O)(=O)O[C@@H]1[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H]1OP(O)(O)=O |
| Size | inquire |
| Supplier Page | https://www.formulationbio.com/phytic-acid-solution-item-2194.html |