β-Sitosterol
β-Sitosterol, a natural product isolated and purified from the herbs of Anemone cathayensis Kitag., is one of several phytosterols (plant sterols) with chemical structures similar to that of cholesterol.
| Trivial name | SKF 14463; beta-Sitosterol |
| Catalog Number | CSN10437 |
| Alternative Name(s) | SKF 14463; beta-Sitosterol |
| Research Area | Metabolic Disease |
| Molecular Formula | C29H50O |
| CAS# | 83-46-5 |
| Purity | ≥90% |
| SMILES | CC[C@@H](C(C)C)CC[C@@H](C)[C@H]1CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/b-sitosterol.html |