β-Sitosterol 50mg
β-sitosterol reduces blood levels of cholesterol, and is sometimes used in treating hypercholesterolemia. β-Sitosterol inhibits cholesterol absorption in the intestine. When the sterol is absorbed in the intestine, it is transported by lipoproteins and incorporated into the cellular membrane.
| Trivial name | β-Sitosterol 50mg |
| Catalog Number | A11015-50 |
| Alternative Name(s) | 24-Ethylcholest-5-en-3beta-ol; alpha-Dihydrofucosterol; 22,23-Dihydrostigmasterol; 24beta-Ethylcholesterol; 5-Stigmasten-3beta-ol |
| Molecular Formula | C29H50O |
| CAS# | 83-46-5 |
| SMILES | CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C(C)C |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/beta-sitosterol.html |
