4-Acetylaminoantipyrine | MedChemExpress (MCE)
4-Acetylaminoantipyrine (4-AA) is a derivative of antipyrine (HY-B0171). 4-Acetylaminoantipyrine acts as a PGE2-dependent blocker and inhibitor of cyclooxygenase (COX)[1]. 4-Acetylaminoantipyrine can inhibit Cu/ZnSOD[2]. 4-Acetylaminoantipyrine can spontaneously bind with bovine serum albumin (BSA) and alter its conformation[3].
| Trivial name | 4-Acetylaminoantipyrine |
| Catalog Number | HY-W268542 |
| Research Area | Inflammation/Immunology; Cancer |
| CAS# | 83-15-8 |
| Purity | ≥98.0% |
| SMILES | CC1=C(NC(C)=O)C(N(N1C)C2=CC=CC=C2)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/4-acetylaminoantipyrine.html |