Palbociclib Isethionate
Palbociclib Isethionate is a highly selective inhibitor of CDK4/6 with IC50 of 11 nM/16 nM in cell-free assays. It shows no activity against CDK1/2/5, EGFR, FGFR, PDGFR, InsR, etc. Phase 3.
| Trivial name | PD0332991 Isethionate |
| Catalog Number | S1579 |
| Molecular Formula | C20H11Cl2NO4 |
| CAS# | 827022-33-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | OC1=C(Cl)C=C(C=C1Cl)/C=C/2C(=O)NC3=C2C=C(C=C3)C(=O)C4=CC=CO4 |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/pd-0332991-palbociclib-isethionate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/PD-0332991-Palbociclib-Isethionate-chemical-structure-s1579.gif |