PD 0332991 Isethionate 10mM * 1mL in DMSO
PD 0332991 Isethionate is a highly selective inhibitor of CDK4/6 with IC50 of 11 nM/16 nM respectively.
Trivial name | PD 0332991 Isethionate 10mM * 1mL in DMSO |
Catalog Number | A13811-10mM-D |
Alternative Name(s) | 6-acetyl-8-cyclopentyl-5-methyl-2-((5-(piperazin-1-yl)pyridin-2-yl)amino)pyrido[2,3-d]pyrimidin-7(8H)-one hydrochloride |
Molecular Formula | C₂₄H₃₀ClN₇O₂ |
CAS# | 827022-33-3 |
SMILES | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N4CCNCC4)C5CCCC5)C(=O)C.C(CS(=O)(=O)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/pd-0332991-isethionate.html |