Evista 10mM * 1mL in DMSO
Raloxifene is an oral selective estrogen receptor modulator (SERM) that has estrogenic actions on bone and anti-estrogenic actions on the uterus and breast. It is used in the prevention of osteoporosis in postmenopausal women.
| Trivial name | Evista 10mM * 1mL in DMSO |
| Catalog Number | A10375-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C28H28ClNO4S |
| CAS# | 82640-04-8 |
| SMILES | C1CCN(CC1)CCOC2=CC=C(C=C2)C(=O)C3=C(SC4=C3C=CC(=C4)O)C5=CC=C(C=C5)O.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/evista-raloxifene-hydrochloride.html |