Mecamylamine Hydrochloride
Mecamylamine hydrochloride is an orally active, nonselective, noncompetitive nAChR(nicotinic acetylcholine receptors) antagonist.It is also a ganglionic blocker and can across the blood-brain barrier. It can be used in the research of neuropsychiatric disorders, hypertension, antidepressant area.
| Catalog Number | S9459 |
| Molecular Formula | C11H21N.ClH |
| CAS# | 826-39-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | Cl.CNC1(C)C2CCC(C2)C1(C)C |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/mecamylamine-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/S9459-Mecamylamine-Hydrochloride-chemical-structure.png |