Ozagrel(OKY-046) 10mM * 1mL in DMSO
Ozagrel is a potent and selective thromboxane A2 synthetase inhibitor with an IC50 of 4 nM.
| Trivial name | Ozagrel(OKY-046) 10mM * 1mL in DMSO |
| Catalog Number | A10688-10mM-D |
| Alternative Name(s) | 3-?[4-?(1H-?imidazol-?1-?ylmethyl)phenyl]-?2E-?propenoic acid |
| Molecular Formula | C13H12N2O2 |
| CAS# | 82571-53-7 |
| SMILES | C1=CC(=CC=C1CN2C=CN=C2)/C=C/C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ozagrel-oky-046.html |