Dipeptide Diaminobutyroyl Benzylamide Diacetate
Dipeptide Diaminobutyroyl Benzylamide Diacetate, categorized as a neuro-peptide, is believed to block the body’s uptake of Na+, which in turn causes the facial muscles to relax and prevent the formation of expression lines (wrinkles).
| Catalog Number | CPC1608 |
| Alternative Name(s) | Syn-ake, Butanamide, UNII-38H206R00R |
| Research Area | Dipeptide Diaminobutyroyl Benzylamide Diacetate, as a safer alternative to botox, is mostly used in anti-aging products to inhibite muscle contractions and reduce wrinkles. |
| Molecular Formula | C19H29N5O3.2(C2H4O2) |
| CAS# | 823202-99-9 |
| Purity | >95% |
| Inchi | InChI=1S/C19H29N5O3.2C2H4O2/c20-10-8-15(18(26)22-13-14-5-2-1-3-6-14)23-19(27)16-7-4-12-24(16)17(25)9-11-21;2*1-2(3)4/h1-3,5-6,15-16H,4,7-13,20-21H2,(H,22,26)(H,23,27);2*1H3,(H,3,4)/t15-,16-;;/m0../s1 |
| Inchi Key | HSUGRPOJOBRRBK-SXBSVMRRSA-N |
| SMILES | CC(=O)O.CC(=O)O.C1C[C@H](N(C1)C(=O)CCN)C(=O)N[C@@H](CCN)C(=O)NCC2=CC=CC=C2 |
| Size | Inquiry |
| Supplier Page | https://www.creative-peptides.com/product/dipeptide-diaminobutyroyl-benzylamide-diacetate-item-cpc1608-141.html |