Atomoxetine Hydrochloride
API Standard
| Catalog Number | CS-O-14646 |
| Alternative Name(s) | (R)-N-methyl-3-phenyl-3-(o-tolyloxy)propan-1-amine hydrchloride |
| Research Area | Atomoxetine Hydrochloride is the hydrochloride salt of atomoxetine, a phenoxy-3-propylamine derivative and selective non-stimulant, norepinephrine reuptake inhibitor with cognitive-enhancing activity. Although its precise mechanism of action is unknown, a |
| Molecular Formula | C17H2ClNO |
| CAS# | 82248-59-7 |
| Purity | >98% |
| SMILES | CC1=C(C=CC=C1)O[C@@H](C2=CC=CC=C2)CCNC.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO14646.html |